3D model is for representation purpose only.
.
.
![]() |
![]() |
![]() |
![]() |
![]() |
|---|---|---|---|---|
| XAFKK | (T-4)-[2-[4-azido-1-(4-iodo-3,5-dimethyl-2H-pyrrol-2-ylidene-κN)butyl]-4-iodo-3,5-dimethyl-1H-pyrrolato-κN]difluoro-boron |
| Identification | |
|---|---|
| ConjuPepDB ID | cpd00150 |
| Smiles | |
| Molecular weight | 1341.4 |
| Molecular formula | C53H76[B+3][F-]2I2N12[N-]O9 | Peptide information |
| Sequence (one letter) | XAFKK |
| Length | 5 |
| Peptide name | autoinducing peptide (AIP) |
| External ID | |
|---|---|
| CAS number | 2093173-44-3 |
| Other information | |
|---|---|
| Application | Antimicrobial therapy, antibacterial (Staphylococcus aureus) |
| Additional function | Fluorophore and cytotoxic photosensitizer conjugations |
| Pharmacological class | antimicrobial, antibacterial |
| Conjugate type | amide |
| Linker | no |
| Small molecule | (T-4)-[2-[4-azido-1-(4-iodo-3,5-dimethyl-2H-pyrrol-2-ylidene-κN)butyl]-4-iodo-3,5-dimethyl-1H-pyrrolato-κN]difluoro-boron |
| Small molecule CAS | 1459727-95-7 |
| Small molecule structure | |
26
| Citations | |||||
|---|---|---|---|---|---|
| ID | Title | Year | Authors | Journal | DOI |
Truncated Autoinducing Peptide Conjugates Selectively Recognize and Kill Staphylococcus aureus | 2017 | Tsuchikama, Kyoji; Shimamoto, Yasuhiro; Anami, Yasuaki | ACS Infectious Diseases | ||